C13H22O — CID 151373248
4,4-bis(ethenyl)-2,2,3,3-tetramethyloxane (PubChem CID 151373248) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 4,4-bis(ethenyl)-2,2,3,3-tetramethyloxane.
| Compound Name | 4,4-bis(ethenyl)-2,2,3,3-tetramethyloxane |
|---|---|
| PubChem CID | 151373248 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4,4-bis(ethenyl)-2,2,3,3-tetramethyloxane |
| SMILES | C=CC1(C=C)CCOC(C)(C)C1(C)C |
| InChI | InChI=1S/C13H22O/c1-7-13(8-2)9-10-14-12(5,6)11(13,3)4/h7-8H,1-2,9-10H2,3-6H3 |
| InChIKey | OQWUTHQLYANNFA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|