About ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate
ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate (PubChem CID 15137541) has the molecular formula C9H12N2O4S
and a molecular weight of 244.27 g/mol. Its IUPAC name is ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate |
| PubChem CID | 15137541 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate |
| SMILES | CCOC(=O)C(NC(C)=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O4S/c1-3-15-8(13)7(10-5(2)12)6-4-16-9(14)11-6/h4,7H,3H2,1-2H3,(H,10,12)(H,11,14) |
| InChIKey | ALHBURWRBSPWJX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate?
The IUPAC name of ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate (CID 15137541) is ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate?
The canonical SMILES for ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate is CCOC(=O)C(NC(C)=O)c1csc(=O)[nH]1.
What is the InChIKey of ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate?
The InChIKey is ALHBURWRBSPWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S/c1-3-15-8(13)7(10-5(2)12)6-4-16-9(14)11-6/h4,7H,3H2,1-2H3,(H,10,12)(H,11,14).
What are the key properties of ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate?
ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate has a molecular weight of 244.27 g/mol, XLogP of 0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetamido-2-(2-oxo-3H-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 15137541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).