C25H46F3NO3 — CID 151382246
methyl 4-[1-(10,10-diethyldodecoxy)-2,2,2-trifluoroethyl]piperidine-1-carboxylate (PubChem CID 151382246) has the molecular formula C25H46F3NO3 and a molecular weight of 465.64 g/mol. Its IUPAC name is methyl 4-[1-(10,10-diethyldodecoxy)-2,2,2-trifluoroethyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[1-(10,10-diethyldodecoxy)-2,2,2-trifluoroethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151382246 |
| Molecular Formula | C25H46F3NO3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | methyl 4-[1-(10,10-diethyldodecoxy)-2,2,2-trifluoroethyl]piperidine-1-carboxylate |
| SMILES | CCC(CC)(CC)CCCCCCCCCOC(C1CCN(C(=O)OC)CC1)C(F)(F)F |
| InChI | InChI=1S/C25H46F3NO3/c1-5-24(6-2,7-3)17-13-11-9-8-10-12-14-20-32-22(25(26,27)28)21-15-18-29(19-16-21)23(30)31-4/h21-22H,5-20H2,1-4H3 |
| InChIKey | OSQWBGWWUZFDAW-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|