About 5-bromopent-3-enoyl chloride
5-bromopent-3-enoyl chloride (PubChem CID 151384213) has the molecular formula C5H6BrClO
and a molecular weight of 197.46 g/mol. Its IUPAC name is 5-bromopent-3-enoyl chloride.
Molecular Properties
| Compound Name | 5-bromopent-3-enoyl chloride |
| PubChem CID | 151384213 |
| Molecular Formula | C5H6BrClO |
| Molecular Weight | 197.46 g/mol |
| Exact Mass | 195.93 |
| IUPAC Name | 5-bromopent-3-enoyl chloride |
| SMILES | O=C(Cl)CC=CCBr |
| InChI | InChI=1S/C5H6BrClO/c6-4-2-1-3-5(7)8/h1-2H,3-4H2 |
| InChIKey | OTBGEEKIZYTAAJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopent-3-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopent-3-enoyl chloride?
The IUPAC name of 5-bromopent-3-enoyl chloride (CID 151384213) is 5-bromopent-3-enoyl chloride.
What is the SMILES notation for 5-bromopent-3-enoyl chloride?
The canonical SMILES for 5-bromopent-3-enoyl chloride is O=C(Cl)CC=CCBr.
What is the InChIKey of 5-bromopent-3-enoyl chloride?
The InChIKey is OTBGEEKIZYTAAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrClO/c6-4-2-1-3-5(7)8/h1-2H,3-4H2.
What are the key properties of 5-bromopent-3-enoyl chloride?
5-bromopent-3-enoyl chloride has a molecular weight of 197.46 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopent-3-enoyl chloride is sourced from PubChem (CID 151384213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).