C23H29F3N6O — CID 151386945
N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-6-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 151386945) has the molecular formula C23H29F3N6O and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-6-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-6-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 151386945 |
| Molecular Formula | C23H29F3N6O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-6-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CC(C)C/N=C(\N)Nc1cc(C(C)NC(=O)N2CCc3cc(C(F)(F)F)ccc3C2)ccn1 |
| InChI | InChI=1S/C23H29F3N6O/c1-14(2)12-29-21(27)31-20-11-16(6-8-28-20)15(3)30-22(33)32-9-7-17-10-19(23(24,25)26)5-4-18(17)13-32/h4-6,8,10-11,14-15H,7,9,12-13H2,1-3H3,(H,30,33)(H3,27,28,29,31) |
| InChIKey | OTPRLRHJEZIWIX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|