C25H28F3N2O6S- — CID 151386962
N-[(2S)-2-(2,2-dimethyl-3-oxopropyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-N-(1,1,1-trifluoro-2-methylpropan-2-yl)carbamate (PubChem CID 151386962) has the molecular formula C25H28F3N2O6S- and a molecular weight of 541.57 g/mol. Its IUPAC name is N-[(2S)-2-(2,2-dimethyl-3-oxopropyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-N-(1,1,1-trifluoro-2-methylpropan-2-yl)carbamate.
| Compound Name | N-[(2S)-2-(2,2-dimethyl-3-oxopropyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-N-(1,1,1-trifluoro-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 151386962 |
| Molecular Formula | C25H28F3N2O6S- |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[(2S)-2-(2,2-dimethyl-3-oxopropyl)-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-N-(1,1,1-trifluoro-2-methylpropan-2-yl)carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](CC(C)(C)C=O)Oc3ccc(N(C(=O)[O-])C(C)(C)C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C25H29F3N2O6S/c1-16-6-9-19(10-7-16)37(34,35)29-14-18(13-23(2,3)15-31)36-21-11-8-17(12-20(21)29)30(22(32)33)24(4,5)25(26,27)28/h6-12,15,18H,13-14H2,1-5H3,(H,32,33)/p-1/t18-/m0/s1 |
| InChIKey | OTPURFOVVRMZQE-SFHVURJKSA-M |
| XLogP | 4.06 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|