C14H29N3O4 — CID 15138893
methyl (2S)-2-[[(2S,3R)-3,7-diamino-2-hydroxyheptanoyl]amino]-4-methylpentanoate (PubChem CID 15138893) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3R)-3,7-diamino-2-hydroxyheptanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S,3R)-3,7-diamino-2-hydroxyheptanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 15138893 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | methyl (2S)-2-[[(2S,3R)-3,7-diamino-2-hydroxyheptanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H](O)[C@H](N)CCCCN |
| InChI | InChI=1S/C14H29N3O4/c1-9(2)8-11(14(20)21-3)17-13(19)12(18)10(16)6-4-5-7-15/h9-12,18H,4-8,15-16H2,1-3H3,(H,17,19)/t10-,11+,12+/m1/s1 |
| InChIKey | UTZANZDVXKQHCJ-WOPDTQHZSA-N |
| XLogP | -0.49 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|