About cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone
cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone (PubChem CID 151389961) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone |
| PubChem CID | 151389961 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone |
| SMILES | COC1(C(=O)C2CCCCC2)C(C)=CC=C1C |
| InChI | InChI=1S/C15H22O2/c1-11-9-10-12(2)15(11,17-3)14(16)13-7-5-4-6-8-13/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | OUFSYWQYEPJGFH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone?
The IUPAC name of cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone (CID 151389961) is cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone.
What is the SMILES notation for cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone?
The canonical SMILES for cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone is COC1(C(=O)C2CCCCC2)C(C)=CC=C1C.
What is the InChIKey of cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone?
The InChIKey is OUFSYWQYEPJGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-11-9-10-12(2)15(11,17-3)14(16)13-7-5-4-6-8-13/h9-10,13H,4-8H2,1-3H3.
What are the key properties of cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone?
cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone has a molecular weight of 234.34 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(1-methoxy-2,5-dimethylcyclopenta-2,4-dien-1-yl)methanone is sourced from PubChem (CID 151389961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).