C17H24O — CID 15139184
(2S,4aS,10aR)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 15139184) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S,4aS,10aR)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2S,4aS,10aR)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 15139184 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2S,4aS,10aR)-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)c3ccccc3CC[C@@H]12 |
| InChI | InChI=1S/C17H24O/c1-16(2)14-9-8-12-6-4-5-7-13(12)17(14,3)11-10-15(16)18/h4-7,14-15,18H,8-11H2,1-3H3/t14-,15-,17+/m0/s1 |
| InChIKey | AWWWBLIRAJUXTH-YQQAZPJKSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |