C19H23NO7 — CID 15139203
[(1S,6S,7R,8R,8aR)-1,8-diacetyloxy-6-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate (PubChem CID 15139203) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,8-diacetyloxy-6-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,8-diacetyloxy-6-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate |
|---|---|
| PubChem CID | 15139203 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,8-diacetyloxy-6-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@@H](OC(C)=O)CCN2CC(O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO7/c1-11(21)25-15-8-9-20-10-14(23)17(18(16(15)20)26-12(2)22)27-19(24)13-6-4-3-5-7-13/h3-7,14-18,23H,8-10H2,1-2H3/t14?,15-,16+,17+,18+/m0/s1 |
| InChIKey | WPQSPRBWBBSFLT-RKSHBFDDSA-N |
| XLogP | 0.52 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|