About (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate
(4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate (PubChem CID 15139698) has the molecular formula C24H19BrO4
and a molecular weight of 451.32 g/mol. Its IUPAC name is (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate |
| PubChem CID | 15139698 |
| Molecular Formula | C24H19BrO4 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate |
| SMILES | C=Cc1ccc2c(c1)c(=O)oc1c2ccc2c(OC(=O)C(C)(C)C)ccc(Br)c21 |
| InChI | InChI=1S/C24H19BrO4/c1-5-13-6-7-14-15-8-9-16-19(28-23(27)24(2,3)4)11-10-18(25)20(16)21(15)29-22(26)17(14)12-13/h5-12H,1H2,2-4H3 |
| InChIKey | XGNLAPKSPQXQGY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate?
The IUPAC name of (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate (CID 15139698) is (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate is C=Cc1ccc2c(c1)c(=O)oc1c2ccc2c(OC(=O)C(C)(C)C)ccc(Br)c21.
What is the InChIKey of (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate?
The InChIKey is XGNLAPKSPQXQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19BrO4/c1-5-13-6-7-14-15-8-9-16-19(28-23(27)24(2,3)4)11-10-18(25)20(16)21(15)29-22(26)17(14)12-13/h5-12H,1H2,2-4H3.
What are the key properties of (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate?
(4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate has a molecular weight of 451.32 g/mol, XLogP of 6.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-8-ethenyl-6-oxonaphtho[1,2-c]isochromen-1-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 15139698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).