C38H52O4Si — CID 15139781
(4S,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6,8-trimethyl-9-trityloxynon-1-en-3-one (PubChem CID 15139781) has the molecular formula C38H52O4Si and a molecular weight of 600.92 g/mol. Its IUPAC name is (4S,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6,8-trimethyl-9-trityloxynon-1-en-3-one.
| Compound Name | (4S,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6,8-trimethyl-9-trityloxynon-1-en-3-one |
|---|---|
| PubChem CID | 15139781 |
| Molecular Formula | C38H52O4Si |
| Molecular Weight | 600.92 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | (4S,5R,6R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6,8-trimethyl-9-trityloxynon-1-en-3-one |
| SMILES | C=C(C)C(=O)[C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H52O4Si/c1-28(2)34(39)36(40-8)35(42-43(9,10)37(5,6)7)30(4)26-29(3)27-41-38(31-20-14-11-15-21-31,32-22-16-12-17-23-32)33-24-18-13-19-25-33/h11-25,29-30,35-36H,1,26-27H2,2-10H3/t29-,30+,35+,36+/m0/s1 |
| InChIKey | GYLDKGFECXTHBD-KRIQBNCVSA-N |
| XLogP | 9.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.92 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|