C29H39BrF3N5O3Si — CID 151398847
tert-butyl N-[(2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate (PubChem CID 151398847) has the molecular formula C29H39BrF3N5O3Si and a molecular weight of 670.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 151398847 |
| Molecular Formula | C29H39BrF3N5O3Si |
| Molecular Weight | 670.65 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | tert-butyl N-[(2S)-2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC[C@@H]1Nc1ncc(C(F)(F)F)c(-c2cn(COCC[Si](C)(C)C)c3cc(Br)ccc23)n1 |
| InChI | InChI=1S/C29H39BrF3N5O3Si/c1-28(2,3)41-27(39)36-23-9-7-8-22(23)35-26-34-15-21(29(31,32)33)25(37-26)20-16-38(17-40-12-13-42(4,5)6)24-14-18(30)10-11-19(20)24/h10-11,14-16,22-23H,7-9,12-13,17H2,1-6H3,(H,36,39)(H,34,35,37)/t22-,23?/m0/s1 |
| InChIKey | OWAXCWBTCLBLDE-NQCNTLBGSA-N |
| XLogP | 8.05 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|