About [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate
[(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate (PubChem CID 15139932) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate.
Molecular Properties
| Compound Name | [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate |
| PubChem CID | 15139932 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C12H18O3/c1-9(2)5-6-12(14)10(3)7-8-15-11(4)13/h5,7H,6,8H2,1-4H3/b10-7+ |
| InChIKey | UBGDUCGBGYILTH-JXMROGBWSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate?
The IUPAC name of [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate (CID 15139932) is [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate.
What is the SMILES notation for [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate?
The canonical SMILES for [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate is CC(=O)OC/C=C(\C)C(=O)CC=C(C)C.
What is the InChIKey of [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate?
The InChIKey is UBGDUCGBGYILTH-JXMROGBWSA-N. The full InChI is InChI=1S/C12H18O3/c1-9(2)5-6-12(14)10(3)7-8-15-11(4)13/h5,7H,6,8H2,1-4H3/b10-7+.
What are the key properties of [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate?
[(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate has a molecular weight of 210.27 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3,7-dimethyl-4-oxoocta-2,6-dienyl] acetate is sourced from PubChem (CID 15139932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).