C16H10F9I — CID 151399334
1,1,2,2,3,3,4,4,4-nonafluorobutyl(diphenyl)-λ3-iodane (PubChem CID 151399334) has the molecular formula C16H10F9I and a molecular weight of 500.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutyl(diphenyl)-λ3-iodane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(diphenyl)-λ3-iodane |
|---|---|
| PubChem CID | 151399334 |
| Molecular Formula | C16H10F9I |
| Molecular Weight | 500.14 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(diphenyl)-λ3-iodane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)I(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H10F9I/c17-13(18,15(21,22)23)14(19,20)16(24,25)26(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OWDIXXRGTGBTCM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.14 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|