C14H10N2O2S — CID 151400269
methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 151400269) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 151400269 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1cc2cnc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C14H10N2O2S/c1-18-14(17)11-7-10-8-15-12(16-13(10)19-11)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | OWIGURVYQROZSM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |