methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate

C14H10N2O2S — CID 151400269

IUPACmethyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate
SMILESCOC(=O)c1cc2cnc(-c3ccccc3)nc2s1
InChIInChI=1S/C14H10N2O2S/c1-18-14(17)11-7-10-8-15-12(16-13(10)19-11)9-5-3-2-4-6-9/h2-8H,1H3
InChIKeyOWIGURVYQROZSM-UHFFFAOYSA-N
MW270.31 g/mol
LogP3.14
Rot. Bonds2

About methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate

methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 151400269) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate.

Molecular Properties

Compound Namemethyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate
PubChem CID151400269
Molecular FormulaC14H10N2O2S
Molecular Weight270.31 g/mol
Exact Mass270.05
IUPAC Namemethyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate
SMILESCOC(=O)c1cc2cnc(-c3ccccc3)nc2s1
InChIInChI=1S/C14H10N2O2S/c1-18-14(17)11-7-10-8-15-12(16-13(10)19-11)9-5-3-2-4-6-9/h2-8H,1H3
InChIKeyOWIGURVYQROZSM-UHFFFAOYSA-N
XLogP3.14
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.31
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate (CID 151400269) is methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate is COC(=O)c1cc2cnc(-c3ccccc3)nc2s1.
What is the InChIKey of methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is OWIGURVYQROZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2S/c1-18-14(17)11-7-10-8-15-12(16-13(10)19-11)9-5-3-2-4-6-9/h2-8H,1H3.
What are the key properties of methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate?
methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 270.31 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenylthieno[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 151400269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).