C12H14 — CID 15140078
1,2,3,4,4a,8b-hexahydrobiphenylene (PubChem CID 15140078) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,2,3,4,4a,8b-hexahydrobiphenylene.
| Compound Name | 1,2,3,4,4a,8b-hexahydrobiphenylene |
|---|---|
| PubChem CID | 15140078 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1,2,3,4,4a,8b-hexahydrobiphenylene |
| SMILES | c1ccc2c(c1)C1CCCCC21 |
| InChI | InChI=1S/C12H14/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-2,5-6,11-12H,3-4,7-8H2 |
| InChIKey | IAZBSPNHEZJNFI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |