C14H20O4Si — CID 15140312
dimethyl (1S,4R)-7-trimethylsilylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 15140312) has the molecular formula C14H20O4Si and a molecular weight of 280.40 g/mol. Its IUPAC name is dimethyl (1S,4R)-7-trimethylsilylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,4R)-7-trimethylsilylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15140312 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | dimethyl (1S,4R)-7-trimethylsilylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C=C[C@H]1C2[Si](C)(C)C |
| InChI | InChI=1S/C14H20O4Si/c1-17-13(15)10-8-6-7-9(11(10)14(16)18-2)12(8)19(3,4)5/h6-9,12H,1-5H3/t8-,9+,12? |
| InChIKey | JASLHZRTLJCAKX-USUYBEQLSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|