phenylsilylformic acid

C7H8O2Si — CID 151404333

IUPACphenylsilylformic acid
SMILESO=C(O)[SiH2]c1ccccc1
InChIInChI=1S/C7H8O2Si/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,10H2,(H,8,9)
InChIKeyOXECSEAOLHOPAO-UHFFFAOYSA-N
MW152.22 g/mol
LogP0.16
Rot. Bonds2

About phenylsilylformic acid

phenylsilylformic acid (PubChem CID 151404333) has the molecular formula C7H8O2Si and a molecular weight of 152.22 g/mol. Its IUPAC name is phenylsilylformic acid.

Molecular Properties

Compound Namephenylsilylformic acid
PubChem CID151404333
Molecular FormulaC7H8O2Si
Molecular Weight152.22 g/mol
Exact Mass152.03
IUPAC Namephenylsilylformic acid
SMILESO=C(O)[SiH2]c1ccccc1
InChIInChI=1S/C7H8O2Si/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,10H2,(H,8,9)
InChIKeyOXECSEAOLHOPAO-UHFFFAOYSA-N
XLogP0.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.22
LogP ≤ 50.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze phenylsilylformic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenylsilylformic acid?
The IUPAC name of phenylsilylformic acid (CID 151404333) is phenylsilylformic acid.
What is the SMILES notation for phenylsilylformic acid?
The canonical SMILES for phenylsilylformic acid is O=C(O)[SiH2]c1ccccc1.
What is the InChIKey of phenylsilylformic acid?
The InChIKey is OXECSEAOLHOPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2Si/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,10H2,(H,8,9).
What are the key properties of phenylsilylformic acid?
phenylsilylformic acid has a molecular weight of 152.22 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsilylformic acid is sourced from PubChem (CID 151404333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).