C13H22BF3N2O4 — CID 151406916
(3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 151406916) has the molecular formula C13H22BF3N2O4 and a molecular weight of 338.14 g/mol. Its IUPAC name is (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 151406916 |
| Molecular Formula | C13H22BF3N2O4 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@H]2CN(CC(F)(F)F)C[C@H]2[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C13H22BF3N2O4/c15-13(16,17)7-19-5-8-4-12(18,11(20)21)10(9(8)6-19)2-1-3-14(22)23/h8-10,22-23H,1-7,18H2,(H,20,21)/t8-,9+,10-,12-/m0/s1 |
| InChIKey | OXRRIQPIUMBLGM-WYFGTUCQSA-N |
| XLogP | 0.15 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|