About 5,6-dimethylindene-1,3-dione
5,6-dimethylindene-1,3-dione (PubChem CID 15140857) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5,6-dimethylindene-1,3-dione.
Molecular Properties
| Compound Name | 5,6-dimethylindene-1,3-dione |
| PubChem CID | 15140857 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5,6-dimethylindene-1,3-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)CC2=O |
| InChI | InChI=1S/C11H10O2/c1-6-3-8-9(4-7(6)2)11(13)5-10(8)12/h3-4H,5H2,1-2H3 |
| InChIKey | PBSZHPXRHKYMEC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethylindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylindene-1,3-dione?
The IUPAC name of 5,6-dimethylindene-1,3-dione (CID 15140857) is 5,6-dimethylindene-1,3-dione.
What is the SMILES notation for 5,6-dimethylindene-1,3-dione?
The canonical SMILES for 5,6-dimethylindene-1,3-dione is Cc1cc2c(cc1C)C(=O)CC2=O.
What is the InChIKey of 5,6-dimethylindene-1,3-dione?
The InChIKey is PBSZHPXRHKYMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-6-3-8-9(4-7(6)2)11(13)5-10(8)12/h3-4H,5H2,1-2H3.
What are the key properties of 5,6-dimethylindene-1,3-dione?
5,6-dimethylindene-1,3-dione has a molecular weight of 174.20 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylindene-1,3-dione is sourced from PubChem (CID 15140857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).