About 3-fluoro-4,5-dimethyl-1H-pyridin-2-one
3-fluoro-4,5-dimethyl-1H-pyridin-2-one (PubChem CID 151411047) has the molecular formula C7H8FNO
and a molecular weight of 141.14 g/mol. Its IUPAC name is 3-fluoro-4,5-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-fluoro-4,5-dimethyl-1H-pyridin-2-one |
| PubChem CID | 151411047 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 3-fluoro-4,5-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1c[nH]c(=O)c(F)c1C |
| InChI | InChI=1S/C7H8FNO/c1-4-3-9-7(10)6(8)5(4)2/h3H,1-2H3,(H,9,10) |
| InChIKey | OYNMXQSYIDPAKX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-4,5-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4,5-dimethyl-1H-pyridin-2-one?
The IUPAC name of 3-fluoro-4,5-dimethyl-1H-pyridin-2-one (CID 151411047) is 3-fluoro-4,5-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 3-fluoro-4,5-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 3-fluoro-4,5-dimethyl-1H-pyridin-2-one is Cc1c[nH]c(=O)c(F)c1C.
What is the InChIKey of 3-fluoro-4,5-dimethyl-1H-pyridin-2-one?
The InChIKey is OYNMXQSYIDPAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO/c1-4-3-9-7(10)6(8)5(4)2/h3H,1-2H3,(H,9,10).
What are the key properties of 3-fluoro-4,5-dimethyl-1H-pyridin-2-one?
3-fluoro-4,5-dimethyl-1H-pyridin-2-one has a molecular weight of 141.14 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4,5-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 151411047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).