C24H26FNO4 — CID 151415944
8-ethyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 151415944) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is 8-ethyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | 8-ethyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 151415944 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 8-ethyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | CCC1CCCC2C(=O)C3=C(C=C(C(=O)NCc4ccc(F)cc4)C(=O)C3O)CC12 |
| InChI | InChI=1S/C24H26FNO4/c1-2-14-4-3-5-17-18(14)10-15-11-19(22(28)23(29)20(15)21(17)27)24(30)26-12-13-6-8-16(25)9-7-13/h6-9,11,14,17-18,23,29H,2-5,10,12H2,1H3,(H,26,30) |
| InChIKey | OZNICPSVTNGTGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|