About N,1-dibenzyl-2,5-dimethylpiperidin-4-imine
N,1-dibenzyl-2,5-dimethylpiperidin-4-imine (PubChem CID 15141604) has the molecular formula C21H26N2
and a molecular weight of 306.45 g/mol. Its IUPAC name is N,1-dibenzyl-2,5-dimethylpiperidin-4-imine.
Molecular Properties
| Compound Name | N,1-dibenzyl-2,5-dimethylpiperidin-4-imine |
| PubChem CID | 15141604 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N,1-dibenzyl-2,5-dimethylpiperidin-4-imine |
| SMILES | CC1CN(Cc2ccccc2)C(C)C/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2/c1-17-15-23(16-20-11-7-4-8-12-20)18(2)13-21(17)22-14-19-9-5-3-6-10-19/h3-12,17-18H,13-16H2,1-2H3/b22-21+ |
| InChIKey | QJGURNLDGHIBMO-QURGRASLSA-N |
| XLogP | 4.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,1-dibenzyl-2,5-dimethylpiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dibenzyl-2,5-dimethylpiperidin-4-imine?
The IUPAC name of N,1-dibenzyl-2,5-dimethylpiperidin-4-imine (CID 15141604) is N,1-dibenzyl-2,5-dimethylpiperidin-4-imine.
What is the SMILES notation for N,1-dibenzyl-2,5-dimethylpiperidin-4-imine?
The canonical SMILES for N,1-dibenzyl-2,5-dimethylpiperidin-4-imine is CC1CN(Cc2ccccc2)C(C)C/C1=N\Cc1ccccc1.
What is the InChIKey of N,1-dibenzyl-2,5-dimethylpiperidin-4-imine?
The InChIKey is QJGURNLDGHIBMO-QURGRASLSA-N. The full InChI is InChI=1S/C21H26N2/c1-17-15-23(16-20-11-7-4-8-12-20)18(2)13-21(17)22-14-19-9-5-3-6-10-19/h3-12,17-18H,13-16H2,1-2H3/b22-21+.
What are the key properties of N,1-dibenzyl-2,5-dimethylpiperidin-4-imine?
N,1-dibenzyl-2,5-dimethylpiperidin-4-imine has a molecular weight of 306.45 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dibenzyl-2,5-dimethylpiperidin-4-imine is sourced from PubChem (CID 15141604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).