About 2-imino-1-methylpyrimidine-4,6-diamine
2-imino-1-methylpyrimidine-4,6-diamine (PubChem CID 15141702) has the molecular formula C5H9N5
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-imino-1-methylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-imino-1-methylpyrimidine-4,6-diamine |
| PubChem CID | 15141702 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 2-imino-1-methylpyrimidine-4,6-diamine |
| SMILES | [H]/N=c1\nc(N)cc(N)n1C |
| InChI | InChI=1S/C5H9N5/c1-10-4(7)2-3(6)9-5(10)8/h2H,7H2,1H3,(H3,6,8,9) |
| InChIKey | YWAIDTWYKNMKFF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imino-1-methylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-1-methylpyrimidine-4,6-diamine?
The IUPAC name of 2-imino-1-methylpyrimidine-4,6-diamine (CID 15141702) is 2-imino-1-methylpyrimidine-4,6-diamine.
What is the SMILES notation for 2-imino-1-methylpyrimidine-4,6-diamine?
The canonical SMILES for 2-imino-1-methylpyrimidine-4,6-diamine is [H]/N=c1\nc(N)cc(N)n1C.
What is the InChIKey of 2-imino-1-methylpyrimidine-4,6-diamine?
The InChIKey is YWAIDTWYKNMKFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5/c1-10-4(7)2-3(6)9-5(10)8/h2H,7H2,1H3,(H3,6,8,9).
What are the key properties of 2-imino-1-methylpyrimidine-4,6-diamine?
2-imino-1-methylpyrimidine-4,6-diamine has a molecular weight of 139.16 g/mol, XLogP of -0.94, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-1-methylpyrimidine-4,6-diamine is sourced from PubChem (CID 15141702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).