C17H12N2O2 — CID 15141750
4-phenyl-3,10-dihydrofuro[3,4-b][1,5]benzodiazepin-1-one (PubChem CID 15141750) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-phenyl-3,10-dihydrofuro[3,4-b][1,5]benzodiazepin-1-one.
| Compound Name | 4-phenyl-3,10-dihydrofuro[3,4-b][1,5]benzodiazepin-1-one |
|---|---|
| PubChem CID | 15141750 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-phenyl-3,10-dihydrofuro[3,4-b][1,5]benzodiazepin-1-one |
| SMILES | O=C1OCC2=C1Nc1ccccc1N=C2c1ccccc1 |
| InChI | InChI=1S/C17H12N2O2/c20-17-16-12(10-21-17)15(11-6-2-1-3-7-11)18-13-8-4-5-9-14(13)19-16/h1-9,19H,10H2 |
| InChIKey | BMCOQJLKDXWOKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |