2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid

C8H6N4O2S — CID 15141768

IUPAC2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1Sc1ncn[nH]1
InChIInChI=1S/C8H6N4O2S/c13-7(14)5-2-1-3-9-6(5)15-8-10-4-11-12-8/h1-4H,(H,13,14)(H,10,11,12)
InChIKeyDJJSOBFJYHEUQU-UHFFFAOYSA-N
MW222.23 g/mol
LogP1.05
Rot. Bonds3

About 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid

2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 15141768) has the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid
PubChem CID15141768
Molecular FormulaC8H6N4O2S
Molecular Weight222.23 g/mol
Exact Mass222.02
IUPAC Name2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1Sc1ncn[nH]1
InChIInChI=1S/C8H6N4O2S/c13-7(14)5-2-1-3-9-6(5)15-8-10-4-11-12-8/h1-4H,(H,13,14)(H,10,11,12)
InChIKeyDJJSOBFJYHEUQU-UHFFFAOYSA-N
XLogP1.05
TPSA91.76 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.23
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid?
The IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid (CID 15141768) is 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid is O=C(O)c1cccnc1Sc1ncn[nH]1.
What is the InChIKey of 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid?
The InChIKey is DJJSOBFJYHEUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2S/c13-7(14)5-2-1-3-9-6(5)15-8-10-4-11-12-8/h1-4H,(H,13,14)(H,10,11,12).
What are the key properties of 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid?
2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid has a molecular weight of 222.23 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 15141768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).