C10H11F4NO2 — CID 151417681
2,3,3,5-tetrafluoro-N-(3-hydroxypropyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 151417681) has the molecular formula C10H11F4NO2 and a molecular weight of 253.19 g/mol. Its IUPAC name is 2,3,3,5-tetrafluoro-N-(3-hydroxypropyl)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 2,3,3,5-tetrafluoro-N-(3-hydroxypropyl)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 151417681 |
| Molecular Formula | C10H11F4NO2 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2,3,3,5-tetrafluoro-N-(3-hydroxypropyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C(NCCCO)C1=C(F)C(F)(F)CC(F)=C1 |
| InChI | InChI=1S/C10H11F4NO2/c11-6-4-7(8(12)10(13,14)5-6)9(17)15-2-1-3-16/h4,16H,1-3,5H2,(H,15,17) |
| InChIKey | OZWATURAWLGKND-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|