C6H5N5S — CID 15141771
2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrazine (PubChem CID 15141771) has the molecular formula C6H5N5S and a molecular weight of 179.21 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrazine.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrazine |
|---|---|
| PubChem CID | 15141771 |
| Molecular Formula | C6H5N5S |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrazine |
| SMILES | c1cnc(Sc2ncn[nH]2)cn1 |
| InChI | InChI=1S/C6H5N5S/c1-2-8-5(3-7-1)12-6-9-4-10-11-6/h1-4H,(H,9,10,11) |
| InChIKey | RMDVXMXVNMZRLZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |