About 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol
2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol (PubChem CID 151418157) has the molecular formula C9H13F3O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol.
Molecular Properties
| Compound Name | 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol |
| PubChem CID | 151418157 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol |
| SMILES | CC=CC(C)(O)CC1OC(F)C1(F)F |
| InChI | InChI=1S/C9H13F3O2/c1-3-4-8(2,13)5-6-9(11,12)7(10)14-6/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | OZYSJVQNHFFQAD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol?
The IUPAC name of 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol (CID 151418157) is 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol.
What is the SMILES notation for 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol?
The canonical SMILES for 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol is CC=CC(C)(O)CC1OC(F)C1(F)F.
What is the InChIKey of 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol?
The InChIKey is OZYSJVQNHFFQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O2/c1-3-4-8(2,13)5-6-9(11,12)7(10)14-6/h3-4,6-7,13H,5H2,1-2H3.
What are the key properties of 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol?
2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol has a molecular weight of 210.19 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(3,3,4-trifluorooxetan-2-yl)pent-3-en-2-ol is sourced from PubChem (CID 151418157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).