About 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide
5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 151419917) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 151419917 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC1C(C#N)=CC=CC1(C)S(N)(=O)=O |
| InChI | InChI=1S/C9H12N2O2S/c1-7-8(6-10)4-3-5-9(7,2)14(11,12)13/h3-5,7H,1-2H3,(H2,11,12,13) |
| InChIKey | PAIBJCXSVZRZLJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide (CID 151419917) is 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide is CC1C(C#N)=CC=CC1(C)S(N)(=O)=O.
What is the InChIKey of 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is PAIBJCXSVZRZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-7-8(6-10)4-3-5-9(7,2)14(11,12)13/h3-5,7H,1-2H3,(H2,11,12,13).
What are the key properties of 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide?
5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 212.27 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 151419917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).