About 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile
3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile (PubChem CID 151420353) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
| PubChem CID | 151420353 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)n1c(=O)[nH]cc(C#N)c1=O |
| InChI | InChI=1S/C9H11N3O2/c1-9(2,3)12-7(13)6(4-10)5-11-8(12)14/h5H,1-3H3,(H,11,14) |
| InChIKey | PAKHRVPRMGCFFX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile?
The IUPAC name of 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile (CID 151420353) is 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile.
What is the SMILES notation for 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile?
The canonical SMILES for 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile is CC(C)(C)n1c(=O)[nH]cc(C#N)c1=O.
What is the InChIKey of 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile?
The InChIKey is PAKHRVPRMGCFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-9(2,3)12-7(13)6(4-10)5-11-8(12)14/h5H,1-3H3,(H,11,14).
What are the key properties of 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile?
3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile has a molecular weight of 193.21 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile is sourced from PubChem (CID 151420353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).