About methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide
methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide (PubChem CID 15142093) has the molecular formula C11H15IN2S2
and a molecular weight of 366.29 g/mol. Its IUPAC name is methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide.
Molecular Properties
| Compound Name | methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide |
| PubChem CID | 15142093 |
| Molecular Formula | C11H15IN2S2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide |
| SMILES | CS/C(=N\C1=[N+](C)CCC1)c1cccs1.[I-] |
| InChI | InChI=1S/C11H15N2S2.HI/c1-13-7-3-6-10(13)12-11(14-2)9-5-4-8-15-9;/h4-5,8H,3,6-7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YRNDDDSRSFUQCU-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide?
The IUPAC name of methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide (CID 15142093) is methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide.
What is the SMILES notation for methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide?
The canonical SMILES for methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide is CS/C(=N\C1=[N+](C)CCC1)c1cccs1.[I-].
What is the InChIKey of methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide?
The InChIKey is YRNDDDSRSFUQCU-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15N2S2.HI/c1-13-7-3-6-10(13)12-11(14-2)9-5-4-8-15-9;/h4-5,8H,3,6-7H2,1-2H3;1H/q+1;/p-1.
What are the key properties of methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide?
methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide has a molecular weight of 366.29 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)thiophene-2-carboximidothioate iodide is sourced from PubChem (CID 15142093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).