C22H38O2Si — CID 15142242
3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenyloctan-1-one (PubChem CID 15142242) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is 3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenyloctan-1-one.
| Compound Name | 3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenyloctan-1-one |
|---|---|
| PubChem CID | 15142242 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-1-phenyloctan-1-one |
| SMILES | CCCCCC(CC(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-8-9-11-16-20(17-21(23)19-14-12-10-13-15-19)24-25(6,7)22(4,5)18(2)3/h10,12-15,18,20H,8-9,11,16-17H2,1-7H3 |
| InChIKey | HATXVFCLLKUUHS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|