About 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid
4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 151423795) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 151423795 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CCOC1(OCC)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C11H16O4/c1-3-14-11(15-4-2)7-5-9(6-8-11)10(12)13/h5-7H,3-4,8H2,1-2H3,(H,12,13) |
| InChIKey | PBCDWISRWSUPOX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid (CID 151423795) is 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid is CCOC1(OCC)C=CC(C(=O)O)=CC1.
What is the InChIKey of 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is PBCDWISRWSUPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-14-11(15-4-2)7-5-9(6-8-11)10(12)13/h5-7H,3-4,8H2,1-2H3,(H,12,13).
What are the key properties of 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid?
4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 212.24 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethoxycyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 151423795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).