C24H35F13O2 — CID 15142415
10-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)octadecanoic acid (PubChem CID 15142415) has the molecular formula C24H35F13O2 and a molecular weight of 602.52 g/mol. Its IUPAC name is 10-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)octadecanoic acid.
| Compound Name | 10-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)octadecanoic acid |
|---|---|
| PubChem CID | 15142415 |
| Molecular Formula | C24H35F13O2 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 10-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)octadecanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H35F13O2/c1-2-3-4-5-8-11-14-17(15-12-9-6-7-10-13-16-18(38)39)19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h17H,2-16H2,1H3,(H,38,39) |
| InChIKey | JQHUUCVPSCHPPT-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|