C7H11N3 — CID 151424265
1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine (PubChem CID 151424265) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine.
| Compound Name | 1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 151424265 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidine |
| SMILES | C1=NCNC2=C1CCNC2 |
| InChI | InChI=1S/C7H11N3/c1-2-8-4-7-6(1)3-9-5-10-7/h3,8,10H,1-2,4-5H2 |
| InChIKey | BGMSBCRQHUCUCR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |