C27H32F3N5O5S — CID 151424738
benzyl N-[(1S,3S,5R)-3-(2,2-dimethoxyethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 151424738) has the molecular formula C27H32F3N5O5S and a molecular weight of 595.64 g/mol. Its IUPAC name is benzyl N-[(1S,3S,5R)-3-(2,2-dimethoxyethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,3S,5R)-3-(2,2-dimethoxyethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 151424738 |
| Molecular Formula | C27H32F3N5O5S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | benzyl N-[(1S,3S,5R)-3-(2,2-dimethoxyethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | COC(CNC(=O)[C@@H]1C[C@H](NC(=O)OCc2ccccc2)C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1)OC |
| InChI | InChI=1S/C27H32F3N5O5S/c1-38-22(39-2)13-31-24(36)17-8-18(10-19(9-17)35-26(37)40-14-16-6-4-3-5-7-16)34-23-21-11-20(12-27(28,29)30)41-25(21)33-15-32-23/h3-7,11,15,17-19,22H,8-10,12-14H2,1-2H3,(H,31,36)(H,35,37)(H,32,33,34)/t17-,18+,19-/m0/s1 |
| InChIKey | PBHAXTFSMHEFDX-OTWHNJEPSA-N |
| XLogP | 4.41 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|