C19H27ClF2N2O3Si — CID 151425927
2-trimethylsilylethyl 4-[carbonochloridoyl-[(2,4-difluorophenyl)methyl]amino]piperidine-1-carboxylate (PubChem CID 151425927) has the molecular formula C19H27ClF2N2O3Si and a molecular weight of 432.97 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-[carbonochloridoyl-[(2,4-difluorophenyl)methyl]amino]piperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 4-[carbonochloridoyl-[(2,4-difluorophenyl)methyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151425927 |
| Molecular Formula | C19H27ClF2N2O3Si |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-trimethylsilylethyl 4-[carbonochloridoyl-[(2,4-difluorophenyl)methyl]amino]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCC(N(Cc2ccc(F)cc2F)C(=O)Cl)CC1 |
| InChI | InChI=1S/C19H27ClF2N2O3Si/c1-28(2,3)11-10-27-19(26)23-8-6-16(7-9-23)24(18(20)25)13-14-4-5-15(21)12-17(14)22/h4-5,12,16H,6-11,13H2,1-3H3 |
| InChIKey | PBMVJZHBMFQVFL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|