About 9-ethenylcarbazole
9-ethenylcarbazole (PubChem CID 15143) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is 9-ethenylcarbazole.
Molecular Properties
| Compound Name | 9-ethenylcarbazole |
| PubChem CID | 15143 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 9-ethenylcarbazole |
| SMILES | C=Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2 |
| InChIKey | KKFHAJHLJHVUDM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-ethenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylcarbazole?
The IUPAC name of 9-ethenylcarbazole (CID 15143) is 9-ethenylcarbazole.
What is the SMILES notation for 9-ethenylcarbazole?
The canonical SMILES for 9-ethenylcarbazole is C=Cn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-ethenylcarbazole?
The InChIKey is KKFHAJHLJHVUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2.
What are the key properties of 9-ethenylcarbazole?
9-ethenylcarbazole has a molecular weight of 193.25 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylcarbazole is sourced from PubChem (CID 15143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).