C15H20BrF3N2O — CID 151430368
2-bromo-N-butyl-4-morpholin-4-yl-6-(trifluoromethyl)aniline (PubChem CID 151430368) has the molecular formula C15H20BrF3N2O and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-bromo-N-butyl-4-morpholin-4-yl-6-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-butyl-4-morpholin-4-yl-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 151430368 |
| Molecular Formula | C15H20BrF3N2O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-bromo-N-butyl-4-morpholin-4-yl-6-(trifluoromethyl)aniline |
| SMILES | CCCCNc1c(Br)cc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H20BrF3N2O/c1-2-3-4-20-14-12(15(17,18)19)9-11(10-13(14)16)21-5-7-22-8-6-21/h9-10,20H,2-8H2,1H3 |
| InChIKey | PCJUZVDNMXTPIC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|