C41H53N5O6 — CID 151430972
tert-butyl N-[5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentyl]carbamate (PubChem CID 151430972) has the molecular formula C41H53N5O6 and a molecular weight of 711.90 g/mol. Its IUPAC name is tert-butyl N-[5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 151430972 |
| Molecular Formula | C41H53N5O6 |
| Molecular Weight | 711.90 g/mol |
| Exact Mass | 711.40 |
| IUPAC Name | tert-butyl N-[5-[2-butyl-4-(2,4-dimethoxyanilino)-1-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]pentyl]carbamate |
| SMILES | CCCCc1nc2c(Nc3ccc(OC)cc3OC)nc3cc(CCCCCNC(=O)OC(C)(C)C)ccc3c2n1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C41H53N5O6/c1-9-10-15-36-45-37-38(46(36)26-28-17-18-29(48-5)24-34(28)50-7)31-20-16-27(14-12-11-13-22-42-40(47)52-41(2,3)4)23-33(31)44-39(37)43-32-21-19-30(49-6)25-35(32)51-8/h16-21,23-25H,9-15,22,26H2,1-8H3,(H,42,47)(H,43,44) |
| InChIKey | PCMSSTAZKDYXLL-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.90 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|