C67H40N6 — CID 151431468
2,3,4,5,6-pentakis(9H-carbazol-1-yl)benzonitrile (PubChem CID 151431468) has the molecular formula C67H40N6 and a molecular weight of 929.10 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis(9H-carbazol-1-yl)benzonitrile.
| Compound Name | 2,3,4,5,6-pentakis(9H-carbazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 151431468 |
| Molecular Formula | C67H40N6 |
| Molecular Weight | 929.10 g/mol |
| Exact Mass | 928.33 |
| IUPAC Name | 2,3,4,5,6-pentakis(9H-carbazol-1-yl)benzonitrile |
| SMILES | N#Cc1c(-c2cccc3c2[nH]c2ccccc23)c(-c2cccc3c2[nH]c2ccccc23)c(-c2cccc3c2[nH]c2ccccc23)c(-c2cccc3c2[nH]c2ccccc23)c1-c1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C67H40N6/c68-36-52-58(47-26-11-21-42-37-16-1-6-31-53(37)69-63(42)47)60(49-28-13-23-44-39-18-3-8-33-55(39)71-65(44)49)62(51-30-15-25-46-41-20-5-10-35-57(41)73-67(46)51)61(50-29-14-24-45-40-19-4-9-34-56(40)72-66(45)50)59(52)48-27-12-22-43-38-17-2-7-32-54(38)70-64(43)48/h1-35,69-73H |
| InChIKey | PCPICZYEFFTANH-UHFFFAOYSA-N |
| XLogP | 18.07 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.10 |
| LogP ≤ 5 | 18.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |