C29H40Si — CID 151431612
(1-cyclohexylcyclohexa-2,4-dien-1-yl)-(3,5-dimethylphenyl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 151431612) has the molecular formula C29H40Si and a molecular weight of 416.73 g/mol. Its IUPAC name is (1-cyclohexylcyclohexa-2,4-dien-1-yl)-(3,5-dimethylphenyl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (1-cyclohexylcyclohexa-2,4-dien-1-yl)-(3,5-dimethylphenyl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 151431612 |
| Molecular Formula | C29H40Si |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (1-cyclohexylcyclohexa-2,4-dien-1-yl)-(3,5-dimethylphenyl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([SiH](c2cc(C)cc(C)c2)C2(C3CCCCC3)C=CC=CC2)C(C)=C1C |
| InChI | InChI=1S/C29H40Si/c1-20-17-21(2)19-27(18-20)30(28-24(5)22(3)23(4)25(28)6)29(15-11-8-12-16-29)26-13-9-7-10-14-26/h8,11-12,15,17-19,26,28,30H,7,9-10,13-14,16H2,1-6H3 |
| InChIKey | FMARCEKZBLRNML-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|