About 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine
2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine (PubChem CID 151431652) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine.
Molecular Properties
| Compound Name | 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine |
| PubChem CID | 151431652 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine |
| SMILES | CCC1N=CC=CC1(NC(C)C)NC(C)C |
| InChI | InChI=1S/C13H25N3/c1-6-12-13(15-10(2)3,16-11(4)5)8-7-9-14-12/h7-12,15-16H,6H2,1-5H3 |
| InChIKey | PCQFEQXICOOPKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine?
The IUPAC name of 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine (CID 151431652) is 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine.
What is the SMILES notation for 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine?
The canonical SMILES for 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine is CCC1N=CC=CC1(NC(C)C)NC(C)C.
What is the InChIKey of 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine?
The InChIKey is PCQFEQXICOOPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-6-12-13(15-10(2)3,16-11(4)5)8-7-9-14-12/h7-12,15-16H,6H2,1-5H3.
What are the key properties of 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine?
2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine has a molecular weight of 223.36 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine is sourced from PubChem (CID 151431652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).