C18H32Si — CID 15143647
trimethyl-[(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]silane (PubChem CID 15143647) has the molecular formula C18H32Si and a molecular weight of 276.54 g/mol. Its IUPAC name is trimethyl-[(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]silane.
| Compound Name | trimethyl-[(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]silane |
|---|---|
| PubChem CID | 15143647 |
| Molecular Formula | C18H32Si |
| Molecular Weight | 276.54 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | trimethyl-[(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]silane |
| SMILES | CC1=C(/C=C/C(C)=C/C[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H32Si/c1-15(12-14-19(5,6)7)10-11-17-16(2)9-8-13-18(17,3)4/h10-12H,8-9,13-14H2,1-7H3/b11-10+,15-12+ |
| InChIKey | XXSFAYGNISYZIN-GCHFJXRNSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|