C21H36N4O3 — CID 151436798
4-(10,10-dimethylundecoxy)-1-(4-nitro-1H-pyrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 151436798) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 4-(10,10-dimethylundecoxy)-1-(4-nitro-1H-pyrazol-5-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(10,10-dimethylundecoxy)-1-(4-nitro-1H-pyrazol-5-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 151436798 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 4-(10,10-dimethylundecoxy)-1-(4-nitro-1H-pyrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)(C)CCCCCCCCCOC1=CCN(c2[nH]ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H36N4O3/c1-21(2,3)13-9-7-5-4-6-8-10-16-28-18-11-14-24(15-12-18)20-19(25(26)27)17-22-23-20/h11,17H,4-10,12-16H2,1-3H3,(H,22,23) |
| InChIKey | PDRFEIRVYMKEGQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|