C19H14Cl2N2O3 — CID 151437949
N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]cyclopropanecarboxamide (PubChem CID 151437949) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 151437949 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-2,3-dioxoindol-5-yl]cyclopropanecarboxamide |
| SMILES | O=C1C(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(NC(=O)C3CC3)cc21 |
| InChI | InChI=1S/C19H14Cl2N2O3/c20-14-5-1-10(7-15(14)21)9-23-16-6-4-12(22-18(25)11-2-3-11)8-13(16)17(24)19(23)26/h1,4-8,11H,2-3,9H2,(H,22,25) |
| InChIKey | PDXHJPPVTUEBIN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|