About (3-propylthiophen-2-yl) acetate
(3-propylthiophen-2-yl) acetate (PubChem CID 151443720) has the molecular formula C9H12O2S
and a molecular weight of 184.26 g/mol. Its IUPAC name is (3-propylthiophen-2-yl) acetate.
Molecular Properties
| Compound Name | (3-propylthiophen-2-yl) acetate |
| PubChem CID | 151443720 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (3-propylthiophen-2-yl) acetate |
| SMILES | CCCc1ccsc1OC(C)=O |
| InChI | InChI=1S/C9H12O2S/c1-3-4-8-5-6-12-9(8)11-7(2)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | PFBBRXWUVNDYPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-propylthiophen-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propylthiophen-2-yl) acetate?
The IUPAC name of (3-propylthiophen-2-yl) acetate (CID 151443720) is (3-propylthiophen-2-yl) acetate.
What is the SMILES notation for (3-propylthiophen-2-yl) acetate?
The canonical SMILES for (3-propylthiophen-2-yl) acetate is CCCc1ccsc1OC(C)=O.
What is the InChIKey of (3-propylthiophen-2-yl) acetate?
The InChIKey is PFBBRXWUVNDYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2S/c1-3-4-8-5-6-12-9(8)11-7(2)10/h5-6H,3-4H2,1-2H3.
What are the key properties of (3-propylthiophen-2-yl) acetate?
(3-propylthiophen-2-yl) acetate has a molecular weight of 184.26 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propylthiophen-2-yl) acetate is sourced from PubChem (CID 151443720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).