C16H18O6S — CID 151445907
1-methyl-3-(4-methylsulfonylphenyl)cyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 151445907) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-methyl-3-(4-methylsulfonylphenyl)cyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 1-methyl-3-(4-methylsulfonylphenyl)cyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151445907 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-methyl-3-(4-methylsulfonylphenyl)cyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CC=CC(C(=O)O)(c2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C16H18O6S/c1-15(13(17)18)8-3-9-16(10-15,14(19)20)11-4-6-12(7-5-11)23(2,21)22/h3-7,9H,8,10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | PFMCJFONGQQSHG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|